CAS 1187436-93-6 is the registry number for 2-Fluoro-6-methylbenzenesulfonamide 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-fluoro-6-methylbenzenesulfonamide (CAS 1187436-93-6) is a chemical compound with the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. IUPAC name: 2-fluoro-6-methylbenzenesulfonamide. InChIKey: NPMUFPNBUHGQOL-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO2S |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-fluoro-6-methylbenzenesulfonamide |
| InChIKey | NPMUFPNBUHGQOL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)F)S(=O)(=O)N |
Computed by PubChem (NCBI)