CAS 118779-53-6 appears in our catalog under these names: Modafinil EP Impurity B (Modafinil USP Related Compound B, Modafinil Sulfone), Modafinil Sulfone, >95% (HPLC), 2-((Diphenylmethyl)sulfonyl)acetamide. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 100mg, 10mg, 25mg.
2-benzhydrylsulfonylacetamide (CAS 118779-53-6) is a chemical compound with the molecular formula C15H15NO3S and a molecular weight of 289.4 g/mol. IUPAC name: 2-benzhydrylsulfonylacetamide. InChIKey: ZESNOWZYHYRSRY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 2-benzhydrylsulfonylacetamide |
| InChIKey | ZESNOWZYHYRSRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)S(=O)(=O)CC(=O)N |
Computed by PubChem (NCBI)