CAS 1187830-59-6 appears in our catalog under these names: Ethyl 2-amino-1h-indole-3-carboxylate hydrochloride, 95%, Ethyl 2–amino–1H–indole–3–carboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 10g, 250mg.
Ethyl 2-amino-1H-indole-3-carboxylate;hydrochloride (CAS 1187830-59-6) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: ethyl 2-amino-1H-indole-3-carboxylate;hydrochloride. InChIKey: FASLNURJTFOWLH-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | ethyl 2-amino-1H-indole-3-carboxylate;hydrochloride |
| InChIKey | FASLNURJTFOWLH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)