Products 747411-56-9
CAS 747411-56-9 appears in our catalog under these names: 4-[(Chloroacetyl)amino]-n,n-dimethylbenzamide, 95%, 4-(2-Chloroacetamido)-N,N-dimethylbenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide (CAS 747411-56-9) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 4-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide. InChIKey: DDTWPYQAIJYIGK-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 4-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide |
| InChIKey | DDTWPYQAIJYIGK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)NC(=O)CCl |
Computed by PubChem (NCBI)