Products 332061-89-9

CAS 332061-89-9 is the registry number for (R)-3-Amino-4-(4-cyanophenyl)butanoic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

(3R)-3-amino-4-(4-cyanophenyl)butanoic acid;hydrochloride (CAS 332061-89-9) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: (3R)-3-amino-4-(4-cyanophenyl)butanoic acid;hydrochloride. InChIKey: XQQBWUZSLDACSS-HNCPQSOCSA-N.

Identity
Molecular formulaC11H13ClN2O2
Molecular weight240.68 g/mol
IUPAC name(3R)-3-amino-4-(4-cyanophenyl)butanoic acid;hydrochloride
InChIKeyXQQBWUZSLDACSS-HNCPQSOCSA-N
SMILESC1=CC(=CC=C1C[C@H](CC(=O)O)N)C#N.Cl

Computed by PubChem (NCBI)