CAS 1187929-48-1 is the registry number for 5-Bromoindolin-3-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1,2-dihydroindol-3-one;hydrochloride (CAS 1187929-48-1) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 5-bromo-1,2-dihydroindol-3-one;hydrochloride. InChIKey: CZPFPBHDAUKOBU-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 5-bromo-1,2-dihydroindol-3-one;hydrochloride |
| InChIKey | CZPFPBHDAUKOBU-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(N1)C=CC(=C2)Br.Cl |
Computed by PubChem (NCBI)