Products 1187929-53-8
CAS 1187929-53-8 appears in our catalog under these names: 6-Nitro-2,3-dihydro-1h-indole hydrochloride, 95%, 6-Nitroindoline hydrochloride, 97%, 6-Nitro-2,3-dihydro-1h-indole HCl, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
6-nitro-2,3-dihydro-1H-indole;hydrochloride (CAS 1187929-53-8) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 6-nitro-2,3-dihydro-1H-indole;hydrochloride. InChIKey: SBFNYJDQZRSLKC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 6-nitro-2,3-dihydro-1H-indole;hydrochloride |
| InChIKey | SBFNYJDQZRSLKC-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=CC(=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)