CAS 1187932-05-3 is the registry number for (R)-Benzyl 2-(chloromethyl)pyrrolidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 5g.
Benzyl (2R)-2-(chloromethyl)pyrrolidine-1-carboxylate (CAS 1187932-05-3) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: benzyl (2R)-2-(chloromethyl)pyrrolidine-1-carboxylate. InChIKey: GWLBVPAKNFVYLA-GFCCVEGCSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | benzyl (2R)-2-(chloromethyl)pyrrolidine-1-carboxylate |
| InChIKey | GWLBVPAKNFVYLA-GFCCVEGCSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)CCl |
Computed by PubChem (NCBI)