CAS 1187933-27-2 is the registry number for trans-Methyl 4-(4-methoxyphenyl)pyrrolidine-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl (3R,4S)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylate (CAS 1187933-27-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: methyl (3R,4S)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylate. InChIKey: YZBHPTZUARKXKZ-NEPJUHHUSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | methyl (3R,4S)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylate |
| InChIKey | YZBHPTZUARKXKZ-NEPJUHHUSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2CNC[C@@H]2C(=O)OC |
Computed by PubChem (NCBI)