CAS 1188044-28-1 is the registry number for 2-Bromo-4-ethoxybenzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-ethoxy-1,3-benzothiazole (CAS 1188044-28-1) is a chemical compound with the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. IUPAC name: 2-bromo-4-ethoxy-1,3-benzothiazole. InChIKey: QFYJBVFIOIWKAP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNOS |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 2-bromo-4-ethoxy-1,3-benzothiazole |
| InChIKey | QFYJBVFIOIWKAP-UHFFFAOYSA-N |
| SMILES | CCOC1=C2C(=CC=C1)SC(=N2)Br |
Computed by PubChem (NCBI)