CAS 1188045-69-3 is the registry number for 2-Bromo-6-methoxy-4-methylbenzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-bromo-6-methoxy-4-methyl-1,3-benzothiazole (CAS 1188045-69-3) is a chemical compound with the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. IUPAC name: 2-bromo-6-methoxy-4-methyl-1,3-benzothiazole. InChIKey: OWWHABGGUOKGSO-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNOS |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 2-bromo-6-methoxy-4-methyl-1,3-benzothiazole |
| InChIKey | OWWHABGGUOKGSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(S2)Br)OC |
Computed by PubChem (NCBI)