CAS 7028-54-8 is the registry number for 6-Bromo-2-methyl-2h-benzothiazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-2-methyl-4H-1,4-benzothiazin-3-one (CAS 7028-54-8) is a chemical compound with the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. IUPAC name: 6-bromo-2-methyl-4H-1,4-benzothiazin-3-one. InChIKey: WUBGRNFSCYNDSN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNOS |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 6-bromo-2-methyl-4H-1,4-benzothiazin-3-one |
| InChIKey | WUBGRNFSCYNDSN-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(S1)C=CC(=C2)Br |
Computed by PubChem (NCBI)