CAS 1188088-59-6 is the registry number for 2-(Chloromethyl)-4-ethoxybenzo[d]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-4-ethoxy-1,3-benzothiazole (CAS 1188088-59-6) is a chemical compound with the molecular formula C10H10ClNOS and a molecular weight of 227.71 g/mol. IUPAC name: 2-(chloromethyl)-4-ethoxy-1,3-benzothiazole. InChIKey: UMWLGUIITOJWCY-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNOS |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | 2-(chloromethyl)-4-ethoxy-1,3-benzothiazole |
| InChIKey | UMWLGUIITOJWCY-UHFFFAOYSA-N |
| SMILES | CCOC1=C2C(=CC=C1)SC(=N2)CCl |
Computed by PubChem (NCBI)