CAS 1609409-39-3 is the registry number for (4-Phenyl-1,3-thiazol-2-yl)methanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-phenyl-1,3-thiazol-2-yl)methanol;hydrochloride (CAS 1609409-39-3) is a chemical compound with the molecular formula C10H10ClNOS and a molecular weight of 227.71 g/mol. IUPAC name: (4-phenyl-1,3-thiazol-2-yl)methanol;hydrochloride. InChIKey: MLPPLTCEHZASGL-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNOS |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | (4-phenyl-1,3-thiazol-2-yl)methanol;hydrochloride |
| InChIKey | MLPPLTCEHZASGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CO.Cl |
Computed by PubChem (NCBI)