CAS 474370-97-3 is the registry number for 4-(2-Methyl-1,3-thiazol-4-yl)phenol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-(2-methyl-1,3-thiazol-4-yl)phenol;hydrochloride (CAS 474370-97-3) is a chemical compound with the molecular formula C10H10ClNOS and a molecular weight of 227.71 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)phenol;hydrochloride. InChIKey: IGVXEGYGADTIHH-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNOS |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)phenol;hydrochloride |
| InChIKey | IGVXEGYGADTIHH-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)O.Cl |
Computed by PubChem (NCBI)