CAS 1188232-94-1 is the registry number for 6-Bromo-2-(trifluoromethyl)benzo(d)thiazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-2-(trifluoromethyl)-1,3-benzothiazole (CAS 1188232-94-1) is a chemical compound with the molecular formula C8H3BrF3NS and a molecular weight of 282.08 g/mol. IUPAC name: 6-bromo-2-(trifluoromethyl)-1,3-benzothiazole. InChIKey: YQFBGJRCFCOOGJ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NS |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | 6-bromo-2-(trifluoromethyl)-1,3-benzothiazole |
| InChIKey | YQFBGJRCFCOOGJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)