Products 955947-86-1
CAS 955947-86-1 is the registry number for 3-Bromo-5-(trifluoromethyl)phenylisothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-isothiocyanato-5-(trifluoromethyl)benzene (CAS 955947-86-1) is a chemical compound with the molecular formula C8H3BrF3NS and a molecular weight of 282.08 g/mol. IUPAC name: 1-bromo-3-isothiocyanato-5-(trifluoromethyl)benzene. InChIKey: PYUHPMXARCWIAW-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NS |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | 1-bromo-3-isothiocyanato-5-(trifluoromethyl)benzene |
| InChIKey | PYUHPMXARCWIAW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N=C=S)Br)C(F)(F)F |
Computed by PubChem (NCBI)