CAS 1188264-23-4 appears in our catalog under these names: tert-Butyl 5-chlorospiro[indoline-3,4'-piperidine]-1-carboxylate hydrochloride, 95%, tert-Butyl 5-chlorospiro(indoline-3,4'-piperidine)-1-carboxylate hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl 5-chlorospiro[2H-indole-3,4'-piperidine]-1-carboxylate;hydrochloride (CAS 1188264-23-4) is a chemical compound with the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.3 g/mol. IUPAC name: tert-butyl 5-chlorospiro[2H-indole-3,4'-piperidine]-1-carboxylate;hydrochloride. InChIKey: GRLQCOGBMIKUAX-UHFFFAOYSA-N.
| Molecular formula | C17H24Cl2N2O2 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | tert-butyl 5-chlorospiro[2H-indole-3,4'-piperidine]-1-carboxylate;hydrochloride |
| InChIKey | GRLQCOGBMIKUAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCNCC2)C3=C1C=CC(=C3)Cl.Cl |
Computed by PubChem (NCBI)