Products 96480-44-3
CAS 96480-44-3 appears in our catalog under these names: Bisaramil hydrochloride/ 99.64% (existing batch purity), Bisaramil HCl, Bisaramil hydrochloride, Bisaramil (hydrochloride). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
[(1S,5R)-3-ethyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-yl] 4-chlorobenzoate;hydrochloride (CAS 96480-44-3) is a chemical compound with the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.3 g/mol. IUPAC name: [(1S,5R)-3-ethyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-yl] 4-chlorobenzoate;hydrochloride. InChIKey: WLBQWCHCDDUUCW-DNCNHEBUSA-N.
| Molecular formula | C17H24Cl2N2O2 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | [(1S,5R)-3-ethyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-yl] 4-chlorobenzoate;hydrochloride |
| InChIKey | WLBQWCHCDDUUCW-DNCNHEBUSA-N |
| SMILES | CCN1C[C@H]2CN(C[C@@H](C1)C2OC(=O)C3=CC=C(C=C3)Cl)C.Cl |
Computed by PubChem (NCBI)