CAS 1461708-84-8 is the registry number for tert-Butyl N-{1-((3,5-dichlorophenyl)methyl)piperidin-4-yl}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]carbamate (CAS 1461708-84-8) is a chemical compound with the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.3 g/mol. IUPAC name: tert-butyl N-[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]carbamate. InChIKey: JUVAFXVAEPRQDM-UHFFFAOYSA-N.
| Molecular formula | C17H24Cl2N2O2 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | tert-butyl N-[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]carbamate |
| InChIKey | JUVAFXVAEPRQDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC1)CC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)