Products 1188266-14-9
CAS 1188266-14-9 appears in our catalog under these names: Nifedipine-d6, Nifedipine–d6, Nifedipine-d6, 98.0%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 500μg, 10 mg, 5 mg, 1 mg.
Bis(trideuteriomethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 1188266-14-9) is a chemical compound with the molecular formula C17H18N2O6 and a molecular weight of 352.37 g/mol. IUPAC name: bis(trideuteriomethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: HYIMSNHJOBLJNT-LIJFRPJRSA-N.
| Molecular formula | C17H18N2O6 |
|---|---|
| Molecular weight | 352.37 g/mol |
| IUPAC name | bis(trideuteriomethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | HYIMSNHJOBLJNT-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C1=C(NC(=C(C1C2=CC=CC=C2[N+](=O)[O-])C(=O)OC([2H])([2H])[2H])C)C |
Computed by PubChem (NCBI)