Products 1219798-99-8
CAS 1219798-99-8 appears in our catalog under these names: Nifedipine-d4 (2-nitrophenyl-d4), 99 atom % D, min 96% Chemical Purity, Nifedipine-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 5 mg, 1 mg.
Dimethyl 2,6-dimethyl-4-(2,3,4,5-tetradeuterio-6-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 1219798-99-8) is a chemical compound with the molecular formula C17H18N2O6 and a molecular weight of 350.36 g/mol. IUPAC name: dimethyl 2,6-dimethyl-4-(2,3,4,5-tetradeuterio-6-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: HYIMSNHJOBLJNT-KDWZCNHSSA-N.
| Molecular formula | C17H18N2O6 |
|---|---|
| Molecular weight | 350.36 g/mol |
| IUPAC name | dimethyl 2,6-dimethyl-4-(2,3,4,5-tetradeuterio-6-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | HYIMSNHJOBLJNT-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2C(=C(NC(=C2C(=O)OC)C)C)C(=O)OC)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)