CAS 5375-64-4 is the registry number for Miraxanthin-V. Offered by: Chemat Brand. Available pack sizes: on request.
(4Z)-4-[2-[2-(3,4-dihydroxyphenyl)ethylimino]ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid (CAS 5375-64-4) is a chemical compound with the molecular formula C17H18N2O6 and a molecular weight of 346.3 g/mol. IUPAC name: (4Z)-4-[2-[2-(3,4-dihydroxyphenyl)ethylimino]ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid. InChIKey: PDKFHZWVCCZUIF-SOZBWQNXSA-N.
| Molecular formula | C17H18N2O6 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | (4Z)-4-[2-[2-(3,4-dihydroxyphenyl)ethylimino]ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
| InChIKey | PDKFHZWVCCZUIF-SOZBWQNXSA-N |
| SMILES | C\1C(NC(=C/C1=C\C=NCCC2=CC(=C(C=C2)O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)