Products 1189105-39-2
CAS 1189105-39-2 is the registry number for Lettowienolide. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-3H-1-benzofuran-2-one (CAS 1189105-39-2) is a chemical compound with the molecular formula C18H22O3 and a molecular weight of 286.4 g/mol. IUPAC name: 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-3H-1-benzofuran-2-one. InChIKey: BQSTWVNVLQVIEE-NTUHNPAUSA-N.
| Molecular formula | C18H22O3 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-3H-1-benzofuran-2-one |
| InChIKey | BQSTWVNVLQVIEE-NTUHNPAUSA-N |
| SMILES | CC(=CCC/C(=C/CC1=CC(=CC2=C1OC(=O)C2)O)/C)C |
Computed by PubChem (NCBI)