Products 1189175-49-2
CAS 1189175-49-2 is the registry number for 2,4,5-TRIFLUORO-N-METHOXY-N-METHYLBENZAMIDE, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4,5-trifluoro-N-methoxy-N-methylbenzamide (CAS 1189175-49-2) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2,4,5-trifluoro-N-methoxy-N-methylbenzamide. InChIKey: QMVIGHODJREAPZ-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2,4,5-trifluoro-N-methoxy-N-methylbenzamide |
| InChIKey | QMVIGHODJREAPZ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(C=C1F)F)F)OC |
Computed by PubChem (NCBI)