Products 1189374-50-2
CAS 1189374-50-2 appears in our catalog under these names: (±)-Tramadol-d6 HCl (N,N-dimethyl-d6) (cis/trans mixture), 99 atom % D, min 98% Chemical Purity, (±)-Tramadol-d6 HCl (N,N-dimethyl-d6) (cis/trans mixture), >95% (HPLC), (±)-Tramadol-d6 HCl (N,N-dimethyl-d6). Offered by: CDN, TRC, Biosynth. Available pack sizes: 0,01g, 0,005g, 10mg, 5mg, 25mg, 50mg.
(1R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride (CAS 1189374-50-2) is a chemical compound with the molecular formula C16H26ClNO2 and a molecular weight of 305.87 g/mol. IUPAC name: (1R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride. InChIKey: PPKXEPBICJTCRU-YBDDLLAFSA-N.
| Molecular formula | C16H26ClNO2 |
|---|---|
| Molecular weight | 305.87 g/mol |
| IUPAC name | (1R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride |
| InChIKey | PPKXEPBICJTCRU-YBDDLLAFSA-N |
| SMILES | [2H]C([2H])([2H])N(CC1CCCC[C@@]1(C2=CC(=CC=C2)OC)O)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)
Synonyms:
Tramadol-d6 Hydrochloride