Products 36474-71-2
CAS 36474-71-2 is the registry number for (1S,2R)-Tramadol Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
Trans-(1S,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride (CAS 36474-71-2) is a chemical compound with the molecular formula C16H26ClNO2 and a molecular weight of 299.83 g/mol. IUPAC name: trans-(1S,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride. InChIKey: PPKXEPBICJTCRU-VNYZMKMESA-N.
| Molecular formula | C16H26ClNO2 |
|---|---|
| Molecular weight | 299.83 g/mol |
| IUPAC name | trans-(1S,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride |
| InChIKey | PPKXEPBICJTCRU-VNYZMKMESA-N |
| SMILES | CN(C)C[C@H]1CCCC[C@]1(C2=CC(=CC=C2)OC)O.Cl |
Computed by PubChem (NCBI)