Products 1189466-15-6
CAS 1189466-15-6 appears in our catalog under these names: N-Phenyl-d5-N’-(1-(2-phenylethyl))-4-piperidine, N-Despropionyl Fentanyl (N-Phenyl-D5). Offered by: TRC. Available pack sizes: 10mg, 1mg, 25mg.
N-(2,3,4,5,6-pentadeuteriophenyl)-1-(2-phenylethyl)piperidin-4-amine (CAS 1189466-15-6) is a chemical compound with the molecular formula C19H24N2 and a molecular weight of 285.4 g/mol. IUPAC name: N-(2,3,4,5,6-pentadeuteriophenyl)-1-(2-phenylethyl)piperidin-4-amine. InChIKey: ZCMDXDQUYIWEKB-OUHXUHDZSA-N.
| Molecular formula | C19H24N2 |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | N-(2,3,4,5,6-pentadeuteriophenyl)-1-(2-phenylethyl)piperidin-4-amine |
| InChIKey | ZCMDXDQUYIWEKB-OUHXUHDZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC2CCN(CC2)CCC3=CC=CC=C3)[2H])[2H] |
Computed by PubChem (NCBI)