CAS 1189468-68-5 is the registry number for 4,5-Dihydro-5-methyl-3,4-diphenyl-5-isoxazolol-13C2, 15N. Offered by: TRC. Available pack sizes: 10mg, 1mg.
5-(113C)methyl-3,4-diphenyl-(513C,215N)4H-1,2-oxazol-5-ol (CAS 1189468-68-5) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 256.27 g/mol. IUPAC name: 5-(113C)methyl-3,4-diphenyl-(513C,215N)4H-1,2-oxazol-5-ol. InChIKey: LOFHVOCXHGAVHL-JZTCLKRDSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 256.27 g/mol |
| IUPAC name | 5-(113C)methyl-3,4-diphenyl-(513C,215N)4H-1,2-oxazol-5-ol |
| InChIKey | LOFHVOCXHGAVHL-JZTCLKRDSA-N |
| SMILES | [13CH3][13C]1(C(C(=[15N]O1)C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)