Products 938146-99-7
CAS 938146-99-7 appears in our catalog under these names: 4-(2,3-Dihydro-1h-indol-1-ylmethyl)benzoic acid, 95%, 4-(Indolin-1-ylmethyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(2,3-dihydroindol-1-ylmethyl)benzoic acid (CAS 938146-99-7) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: 4-(2,3-dihydroindol-1-ylmethyl)benzoic acid. InChIKey: NNHJFDQPSDKLHK-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 4-(2,3-dihydroindol-1-ylmethyl)benzoic acid |
| InChIKey | NNHJFDQPSDKLHK-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)CC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)