CAS 37799-00-1 is the registry number for 4-Benzyl-4-azatricyclo[5.2.1.0(2,6)]dec-8-ene-3,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-benzyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 37799-00-1) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: 4-benzyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: QKZKKFXTPSCYQI-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 4-benzyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | QKZKKFXTPSCYQI-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)