Products 1189483-96-2
CAS 1189483-96-2 appears in our catalog under these names: Sulfameter-d4, >95% (HPLC), Sulfameter-d4. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
4-amino-2,3,5,6-tetradeuterio-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide (CAS 1189483-96-2) is a chemical compound with the molecular formula C11H12N4O3S and a molecular weight of 284.33 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuterio-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide. InChIKey: GPTONYMQFTZPKC-QFFDRWTDSA-N.
| Molecular formula | C11H12N4O3S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuterio-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide |
| InChIKey | GPTONYMQFTZPKC-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)NC2=NC=C(C=N2)OC)[2H] |
Computed by PubChem (NCBI)