Products 1286538-12-2
CAS 1286538-12-2 appears in our catalog under these names: Sulfamonomethoxine-d4, >95% (HPLC), Sulfamonomethoxine D4, Sulfamonomethoxine-d4, Sulfamonomethoxine-d4, 99.90%. Offered by: TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1mg, 5mg, 10mg, 50mg, 2.5 mg.
4-amino-2,3,5,6-tetradeuterio-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide (CAS 1286538-12-2) is a chemical compound with the molecular formula C11H12N4O3S and a molecular weight of 284.33 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuterio-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide. InChIKey: WMPXPUYPYQKQCX-QFFDRWTDSA-N.
| Molecular formula | C11H12N4O3S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuterio-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide |
| InChIKey | WMPXPUYPYQKQCX-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)NC2=CC(=NC=N2)OC)[2H] |
Computed by PubChem (NCBI)