Products 2704162-84-3
CAS 2704162-84-3 is the registry number for Sulfamonomethoxine-d3-1. Offered by: MedChemExpress. Available pack sizes: 1 mg.
4-amino-N-[6-(trideuteriomethoxy)pyrimidin-4-yl]benzenesulfonamide (CAS 2704162-84-3) is a chemical compound with the molecular formula C11H12N4O3S and a molecular weight of 283.32 g/mol. IUPAC name: 4-amino-N-[6-(trideuteriomethoxy)pyrimidin-4-yl]benzenesulfonamide. InChIKey: WMPXPUYPYQKQCX-FIBGUPNXSA-N.
| Molecular formula | C11H12N4O3S |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 4-amino-N-[6-(trideuteriomethoxy)pyrimidin-4-yl]benzenesulfonamide |
| InChIKey | WMPXPUYPYQKQCX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)