CAS 1189513-51-6 appears in our catalog under these names: 5-Bromo-3-chloropyridine-2-carboxylic acid, 96%, 5-Bromo-3-chloropicolinic acid, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 500g.
5-bromo-3-chloropyridine-2-carboxylic acid (CAS 1189513-51-6) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 5-bromo-3-chloropyridine-2-carboxylic acid. InChIKey: KPHRXSNSIGEBSN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 5-bromo-3-chloropyridine-2-carboxylic acid |
| InChIKey | KPHRXSNSIGEBSN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(=O)O)Br |
Computed by PubChem (NCBI)