CAS 1189647-53-7 is the registry number for 2-Hydroxy Trimipramine-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
11-[2-methyl-3-[methyl(trideuteriomethyl)amino]propyl]-5,6-dihydrobenzo[b][1]benzazepin-3-ol (CAS 1189647-53-7) is a chemical compound with the molecular formula C20H26N2O and a molecular weight of 313.5 g/mol. IUPAC name: 11-[2-methyl-3-[methyl(trideuteriomethyl)amino]propyl]-5,6-dihydrobenzo[b][1]benzazepin-3-ol. InChIKey: FQJSSUOYVSEYPF-BMSJAHLVSA-N.
| Molecular formula | C20H26N2O |
|---|---|
| Molecular weight | 313.5 g/mol |
| IUPAC name | 11-[2-methyl-3-[methyl(trideuteriomethyl)amino]propyl]-5,6-dihydrobenzo[b][1]benzazepin-3-ol |
| InChIKey | FQJSSUOYVSEYPF-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CC(C)CN1C2=C(CCC3=CC=CC=C31)C=C(C=C2)O |
Computed by PubChem (NCBI)