CAS 14171-70-1 appears in our catalog under these names: Trimipramine N–oxide, Trimipramine N-oxide, (2RS)-3-(10,11-Dihydro-5H-dibenzo(b,f)azepin-5-yl)-N,N,2-trimethylpropan-1-amine N-oxide (Trimipramine N-Oxide), Trimipramine N-Oxide, >95% (HPLC). Offered by: GLPBio, Chemat Brand, Mikromol, TRC, TargetMol. Available pack sizes: 1mg, on request, 100mg, 5mg, 10mg, 1 mg, 5 mg.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N,2-trimethylpropan-1-amine oxide (CAS 14171-70-1) is a chemical compound with the molecular formula C20H26N2O and a molecular weight of 310.4 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N,2-trimethylpropan-1-amine oxide. InChIKey: UNOPAPJVNIQNJP-UHFFFAOYSA-N.
| Molecular formula | C20H26N2O |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N,2-trimethylpropan-1-amine oxide |
| InChIKey | UNOPAPJVNIQNJP-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2CCC3=CC=CC=C31)C[N+](C)(C)[O-] |
Computed by PubChem (NCBI)