Products 53716-46-4

CAS 53716-46-4 is the registry number for Anilopam. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 1mg, 500 μg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

4-[2-(7-methoxy-4-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]aniline (CAS 53716-46-4) is a chemical compound with the molecular formula C20H26N2O and a molecular weight of 310.4 g/mol. IUPAC name: 4-[2-(7-methoxy-4-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]aniline. InChIKey: GNCHTURXQMPGMG-UHFFFAOYSA-N.

Identity
Molecular formulaC20H26N2O
Molecular weight310.4 g/mol
IUPAC name4-[2-(7-methoxy-4-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]aniline
InChIKeyGNCHTURXQMPGMG-UHFFFAOYSA-N
SMILESCC1CC2=C(CCN1CCC3=CC=C(C=C3)N)C=CC(=C2)OC

Computed by PubChem (NCBI)