CAS 1189654-25-8 is the registry number for Ethyl (5-Ethyl-2-pyridinyl)-1,1-d2-acetate. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Ethyl 2,2-dideuterio-2-(5-ethyl-2-pyridinyl)acetate (CAS 1189654-25-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 195.25 g/mol. IUPAC name: ethyl 2,2-dideuterio-2-(5-ethyl-2-pyridinyl)acetate. InChIKey: GNXRZBGHRCPLKI-RJSZUWSASA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 195.25 g/mol |
| IUPAC name | ethyl 2,2-dideuterio-2-(5-ethyl-2-pyridinyl)acetate |
| InChIKey | GNXRZBGHRCPLKI-RJSZUWSASA-N |
| SMILES | [2H]C([2H])(C1=NC=C(C=C1)CC)C(=O)OCC |
Computed by PubChem (NCBI)