CAS 1189689-16-4 is the registry number for 1-((3,3-Diphenylpropyl)methylamino)-2-methyl-2-propanol-d3. Offered by: TRC. Available pack sizes: 50mg, 5mg.
1-[3,3-diphenylpropyl(trideuteriomethyl)amino]-2-methylpropan-2-ol (CAS 1189689-16-4) is a chemical compound with the molecular formula C20H27NO and a molecular weight of 300.5 g/mol. IUPAC name: 1-[3,3-diphenylpropyl(trideuteriomethyl)amino]-2-methylpropan-2-ol. InChIKey: MQWDISMNBYOLAB-HPRDVNIFSA-N.
| Molecular formula | C20H27NO |
|---|---|
| Molecular weight | 300.5 g/mol |
| IUPAC name | 1-[3,3-diphenylpropyl(trideuteriomethyl)amino]-2-methylpropan-2-ol |
| InChIKey | MQWDISMNBYOLAB-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC(C1=CC=CC=C1)C2=CC=CC=C2)CC(C)(C)O |
Computed by PubChem (NCBI)