Products 1794768-30-1
CAS 1794768-30-1 appears in our catalog under these names: rac Desisopropyl Tolterodine-d7 Methyl Ether, Tolterodine Ep Impurity D-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
1,1,1,2,3,3,3-heptadeuterio-N-[3-(2-methoxy-5-methylphenyl)-3-phenylpropyl]propan-2-amine (CAS 1794768-30-1) is a chemical compound with the molecular formula C20H27NO and a molecular weight of 304.5 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuterio-N-[3-(2-methoxy-5-methylphenyl)-3-phenylpropyl]propan-2-amine. InChIKey: DPTHIYCZGOKIDH-MSDSXZSWSA-N.
| Molecular formula | C20H27NO |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuterio-N-[3-(2-methoxy-5-methylphenyl)-3-phenylpropyl]propan-2-amine |
| InChIKey | DPTHIYCZGOKIDH-MSDSXZSWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCCC(C1=CC=CC=C1)C2=C(C=CC(=C2)C)OC |
Computed by PubChem (NCBI)