CAS 1585965-04-3 is the registry number for (3S,6R)-NML. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S,6R)-6-(methylamino)-4,4-diphenylheptan-3-ol (CAS 1585965-04-3) is a chemical compound with the molecular formula C20H27NO and a molecular weight of 297.4 g/mol. IUPAC name: (3S,6R)-6-(methylamino)-4,4-diphenylheptan-3-ol. InChIKey: KYHAUJGXNUJCTC-APWZRJJASA-N.
| Molecular formula | C20H27NO |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | (3S,6R)-6-(methylamino)-4,4-diphenylheptan-3-ol |
| InChIKey | KYHAUJGXNUJCTC-APWZRJJASA-N |
| SMILES | CC[C@@H](C(C[C@@H](C)NC)(C1=CC=CC=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)