Products 1189695-13-3
CAS 1189695-13-3 appears in our catalog under these names: Tiopronin 13C D3, Tiopronin 13C D3, Tiopronin-13C,d3, 95.30%. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid (CAS 1189695-13-3) is a chemical compound with the molecular formula C5H9NO3S and a molecular weight of 167.21 g/mol. IUPAC name: 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid. InChIKey: YTGJWQPHMWSCST-HZPPXAECSA-N.
| Molecular formula | C5H9NO3S |
|---|---|
| Molecular weight | 167.21 g/mol |
| IUPAC name | 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid |
| InChIKey | YTGJWQPHMWSCST-HZPPXAECSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)N[13CH2]C(=O)O)S |
Computed by PubChem (NCBI)