CAS 143577-46-2 appears in our catalog under these names: (R)-Tetrahydro-3h-pyrrolo[1,2-c][1,2,3]oxathiazole 1,1-dioxide, 95%, (R)-Tetrahydro-3H-pyrrolo(1,2-c)(1,2,3)oxathiazole 1,1-dioxide, 95%, (R)–Tetrahydro–3H–pyrrolo(1,2–c)(1,2,3)oxathiazole 1,1–dioxide, (R)-4,5,6-Tetrahydro-3H-pyrrolo(1,2-c)oxathiazole 1,1-dioxide. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
(3aR)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide (CAS 143577-46-2) is a chemical compound with the molecular formula C5H9NO3S and a molecular weight of 163.20 g/mol. IUPAC name: (3aR)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide. InChIKey: WFFHPXGNIIMFHE-RXMQYKEDSA-N.
| Molecular formula | C5H9NO3S |
|---|---|
| Molecular weight | 163.20 g/mol |
| IUPAC name | (3aR)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide |
| InChIKey | WFFHPXGNIIMFHE-RXMQYKEDSA-N |
| SMILES | C1C[C@@H]2COS(=O)(=O)N2C1 |
Computed by PubChem (NCBI)