Products 1189700-74-0
CAS 1189700-74-0 appears in our catalog under these names: Tiopronin-d3, Tiopronin-d3, >95% (HPLC), Tiopronin–d3, Tiopronin-d3, 99.42%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 5mg, 1mg, 1 mg.
2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid (CAS 1189700-74-0) is a chemical compound with the molecular formula C5H9NO3S and a molecular weight of 166.22 g/mol. IUPAC name: 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid. InChIKey: YTGJWQPHMWSCST-FIBGUPNXSA-N.
| Molecular formula | C5H9NO3S |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid |
| InChIKey | YTGJWQPHMWSCST-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)NCC(=O)O)S |
Computed by PubChem (NCBI)