CAS 1189709-96-3 appears in our catalog under these names: Mesalazine-13C6, 5-Aminosalicylic acid-13C6. Offered by: Hubei YoungXin, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
5-amino-2-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 1189709-96-3) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 159.09 g/mol. IUPAC name: 5-amino-2-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: KBOPZPXVLCULAV-IDEBNGHGSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 5-amino-2-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | KBOPZPXVLCULAV-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1N)C(=O)O)O |
Computed by PubChem (NCBI)