Products 1309283-32-6
CAS 1309283-32-6 appears in our catalog under these names: Mesalazine-d3, Mesalazine-d3, >95% (HPLC), 5–Aminosalicylic acid–d3, 5-Aminosalicylic acid-d3, 99.38%. Offered by: Hubei YoungXin, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg, 5mg.
3-amino-2,4,5-trideuterio-6-hydroxybenzoic acid (CAS 1309283-32-6) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 156.15 g/mol. IUPAC name: 3-amino-2,4,5-trideuterio-6-hydroxybenzoic acid. InChIKey: KBOPZPXVLCULAV-CBYSEHNBSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 156.15 g/mol |
| IUPAC name | 3-amino-2,4,5-trideuterio-6-hydroxybenzoic acid |
| InChIKey | KBOPZPXVLCULAV-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])C(=O)O)O)[2H] |
Computed by PubChem (NCBI)