CAS 1189712-86-4 is the registry number for 2-Furfurylthiol Acetate-d2. Offered by: TRC. Available pack sizes: 50mg, 5mg.
S-[dideuterio(furan-2-yl)methyl] ethanethioate (CAS 1189712-86-4) is a chemical compound with the molecular formula C7H8O2S and a molecular weight of 158.22 g/mol. IUPAC name: S-[dideuterio(furan-2-yl)methyl] ethanethioate. InChIKey: LQOUTUIIYXYBQW-BFWBPSQCSA-N.
| Molecular formula | C7H8O2S |
|---|---|
| Molecular weight | 158.22 g/mol |
| IUPAC name | S-[dideuterio(furan-2-yl)methyl] ethanethioate |
| InChIKey | LQOUTUIIYXYBQW-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C1=CC=CO1)SC(=O)C |
Computed by PubChem (NCBI)