Products 1189712-86-4

CAS 1189712-86-4 is the registry number for 2-Furfurylthiol Acetate-d2. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

S-[dideuterio(furan-2-yl)methyl] ethanethioate (CAS 1189712-86-4) is a chemical compound with the molecular formula C7H8O2S and a molecular weight of 158.22 g/mol. IUPAC name: S-[dideuterio(furan-2-yl)methyl] ethanethioate. InChIKey: LQOUTUIIYXYBQW-BFWBPSQCSA-N.

Identity
Molecular formulaC7H8O2S
Molecular weight158.22 g/mol
IUPAC nameS-[dideuterio(furan-2-yl)methyl] ethanethioate
InChIKeyLQOUTUIIYXYBQW-BFWBPSQCSA-N
SMILES[2H]C([2H])(C1=CC=CO1)SC(=O)C

Computed by PubChem (NCBI)