CAS 1189727-93-2 appears in our catalog under these names: Didesmethyl Sibutramine-d6, >95% (HPLC), Didesmethyl Sibutramine-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1-[1-(4-chlorophenyl)-2,2,3,3,4,4-hexadeuteriocyclobutyl]-3-methylbutan-1-amine (CAS 1189727-93-2) is a chemical compound with the molecular formula C15H22ClN and a molecular weight of 257.83 g/mol. IUPAC name: 1-[1-(4-chlorophenyl)-2,2,3,3,4,4-hexadeuteriocyclobutyl]-3-methylbutan-1-amine. InChIKey: WQSACWZKKZPCHN-QYDDHRNTSA-N.
| Molecular formula | C15H22ClN |
|---|---|
| Molecular weight | 257.83 g/mol |
| IUPAC name | 1-[1-(4-chlorophenyl)-2,2,3,3,4,4-hexadeuteriocyclobutyl]-3-methylbutan-1-amine |
| InChIKey | WQSACWZKKZPCHN-QYDDHRNTSA-N |
| SMILES | [2H]C1(C(C(C1([2H])[2H])(C2=CC=C(C=C2)Cl)C(CC(C)C)N)([2H])[2H])[2H] |
Computed by PubChem (NCBI)