CAS 1794786-39-2 is the registry number for Fencamfamin-d5 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
N-(1,1,2,2,2-pentadeuterioethyl)-3-phenylbicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 1794786-39-2) is a chemical compound with the molecular formula C15H22ClN and a molecular weight of 256.82 g/mol. IUPAC name: N-(1,1,2,2,2-pentadeuterioethyl)-3-phenylbicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: CVFSMSTXULJISA-LUIAAVAXSA-N.
| Molecular formula | C15H22ClN |
|---|---|
| Molecular weight | 256.82 g/mol |
| IUPAC name | N-(1,1,2,2,2-pentadeuterioethyl)-3-phenylbicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | CVFSMSTXULJISA-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC1C2CCC(C2)C1C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)